About ethane;methane;1-methylindazole
ethane;methane;1-methylindazole (PubChem CID 142166782) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;methane;1-methylindazole.
Molecular Properties
| Compound Name | ethane;methane;1-methylindazole |
| PubChem CID | 142166782 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;methane;1-methylindazole |
| SMILES | C.CC.Cn1ncc2ccccc21 |
| InChI | InChI=1S/C8H8N2.C2H6.CH4/c1-10-8-5-3-2-4-7(8)6-9-10;1-2;/h2-6H,1H3;1-2H3;1H4 |
| InChIKey | MXYVNFDJFOBVRV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methane;1-methylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;1-methylindazole?
The IUPAC name of ethane;methane;1-methylindazole (CID 142166782) is ethane;methane;1-methylindazole.
What is the SMILES notation for ethane;methane;1-methylindazole?
The canonical SMILES for ethane;methane;1-methylindazole is C.CC.Cn1ncc2ccccc21.
What is the InChIKey of ethane;methane;1-methylindazole?
The InChIKey is MXYVNFDJFOBVRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C2H6.CH4/c1-10-8-5-3-2-4-7(8)6-9-10;1-2;/h2-6H,1H3;1-2H3;1H4.
What are the key properties of ethane;methane;1-methylindazole?
ethane;methane;1-methylindazole has a molecular weight of 178.28 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;1-methylindazole is sourced from PubChem (CID 142166782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).