C8H8N2 — CID 59056046
1-methyl-3,5-ditritioindazole (PubChem CID 59056046) has the molecular formula C8H8N2 and a molecular weight of 136.18 g/mol. Its IUPAC name is 1-methyl-3,5-ditritioindazole.
| Compound Name | 1-methyl-3,5-ditritioindazole |
|---|---|
| PubChem CID | 59056046 |
| Molecular Formula | C8H8N2 |
| Molecular Weight | 136.18 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 1-methyl-3,5-ditritioindazole |
| SMILES | [3H]c1ccc2c(c1)c([3H])nn2C |
| InChI | InChI=1S/C8H8N2/c1-10-8-5-3-2-4-7(8)6-9-10/h2-6H,1H3/i2T,6T |
| InChIKey | CSUGQXMRKOKBFI-VULYCBOSSA-N |
| XLogP | 1.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |