C10H12N2 — CID 155790140
3-propan-2-yl-2-tritiopyrazolo[1,5-a]pyridine (PubChem CID 155790140) has the molecular formula C10H12N2 and a molecular weight of 162.23 g/mol. Its IUPAC name is 3-propan-2-yl-2-tritiopyrazolo[1,5-a]pyridine.
| Compound Name | 3-propan-2-yl-2-tritiopyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 155790140 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.11 |
| IUPAC Name | 3-propan-2-yl-2-tritiopyrazolo[1,5-a]pyridine |
| SMILES | [3H]c1nn2ccccc2c1C(C)C |
| InChI | InChI=1S/C10H12N2/c1-8(2)9-7-11-12-6-4-3-5-10(9)12/h3-8H,1-2H3/i7T |
| InChIKey | JVRMJJIGKBPHEC-HKNMUYPKSA-N |
| XLogP | 2.46 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |