C14H25NO2 — CID 143195151
ethane;5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyrrolidine-2-carboxylic acid (PubChem CID 143195151) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyrrolidine-2-carboxylic acid.
| Compound Name | ethane;5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 143195151 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;5-[(2Z,4E)-hepta-2,4-dien-4-yl]pyrrolidine-2-carboxylic acid |
| SMILES | C/C=C\C(=C/CC)C1CCC(C(=O)O)N1.CC |
| InChI | InChI=1S/C12H19NO2.C2H6/c1-3-5-9(6-4-2)10-7-8-11(13-10)12(14)15;1-2/h3,5-6,10-11,13H,4,7-8H2,1-2H3,(H,14,15);1-2H3/b5-3-,9-6+; |
| InChIKey | HCYGGCZKESXFSD-XRVNEYCPSA-N |
| XLogP | 3.13 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|