C8H13NO2 — CID 177295796
(2S,5S)-5-prop-1-enylpyrrolidine-2-carboxylic acid (PubChem CID 177295796) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (2S,5S)-5-prop-1-enylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S,5S)-5-prop-1-enylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 177295796 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2S,5S)-5-prop-1-enylpyrrolidine-2-carboxylic acid |
| SMILES | CC=C[C@@H]1CC[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C8H13NO2/c1-2-3-6-4-5-7(9-6)8(10)11/h2-3,6-7,9H,4-5H2,1H3,(H,10,11)/t6-,7+/m1/s1 |
| InChIKey | GBIAFCAEOPULBB-RQJHMYQMSA-N |
| XLogP | 0.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|