C9H13NO3 — CID 142059042
5-formyl-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid (PubChem CID 142059042) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5-formyl-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 5-formyl-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 142059042 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 5-formyl-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
| SMILES | C/C=C\C1CC(C(=O)O)NC1C=O |
| InChI | InChI=1S/C9H13NO3/c1-2-3-6-4-7(9(12)13)10-8(6)5-11/h2-3,5-8,10H,4H2,1H3,(H,12,13)/b3-2- |
| InChIKey | UISWCPMQECDLOI-IHWYPQMZSA-N |
| XLogP | 0.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|