C7H7Br2N3S — CID 14319516
1-amino-3-(2,6-dibromophenyl)thiourea (PubChem CID 14319516) has the molecular formula C7H7Br2N3S and a molecular weight of 325.03 g/mol. Its IUPAC name is 1-amino-3-(2,6-dibromophenyl)thiourea.
| Compound Name | 1-amino-3-(2,6-dibromophenyl)thiourea |
|---|---|
| PubChem CID | 14319516 |
| Molecular Formula | C7H7Br2N3S |
| Molecular Weight | 325.03 g/mol |
| Exact Mass | 322.87 |
| IUPAC Name | 1-amino-3-(2,6-dibromophenyl)thiourea |
| SMILES | NNC(=S)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C7H7Br2N3S/c8-4-2-1-3-5(9)6(4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13) |
| InChIKey | XXDHVUFTEJUMKN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.03 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|