C12H22N2 — CID 143195789
1,2-bis(ethenyl)-4H-pyrimidine;ethane (PubChem CID 143195789) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 1,2-bis(ethenyl)-4H-pyrimidine;ethane.
| Compound Name | 1,2-bis(ethenyl)-4H-pyrimidine;ethane |
|---|---|
| PubChem CID | 143195789 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 1,2-bis(ethenyl)-4H-pyrimidine;ethane |
| SMILES | C=CC1=NCC=CN1C=C.CC.CC |
| InChI | InChI=1S/C8H10N2.2C2H6/c1-3-8-9-6-5-7-10(8)4-2;2*1-2/h3-5,7H,1-2,6H2;2*1-2H3 |
| InChIKey | WQOXZOPRQGAILQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |