C8H12N2O2S — CID 143198269
5-methyl-3-propyl-6-sulfanyl-1H-pyrimidine-2,4-dione (PubChem CID 143198269) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 5-methyl-3-propyl-6-sulfanyl-1H-pyrimidine-2,4-dione.
| Compound Name | 5-methyl-3-propyl-6-sulfanyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143198269 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-methyl-3-propyl-6-sulfanyl-1H-pyrimidine-2,4-dione |
| SMILES | CCCn1c(=O)[nH]c(S)c(C)c1=O |
| InChI | InChI=1S/C8H12N2O2S/c1-3-4-10-7(11)5(2)6(13)9-8(10)12/h13H,3-4H2,1-2H3,(H,9,12) |
| InChIKey | DIOXUPHKIHKHAU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|