About 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one
7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 14319839) has the molecular formula C7H6N2OS2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
Analyze 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The IUPAC name of 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one (CID 14319839) is 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
What is the SMILES notation for 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The canonical SMILES for 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is CSc1cc(=O)n2ccsc2n1.
What is the InChIKey of 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
The InChIKey is WFWOWPRJYLLYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS2/c1-11-5-4-6(10)9-2-3-12-7(9)8-5/h2-4H,1H3.
What are the key properties of 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one?
7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one has a molecular weight of 198.27 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfanyl-[1,3]thiazolo[3,2-a]pyrimidin-5-one is sourced from PubChem (CID 14319839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).