C10H13N3OS — CID 3064609
5-(diethylamino)-[1,3]thiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3064609) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-(diethylamino)-[1,3]thiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-(diethylamino)-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3064609 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 5-(diethylamino)-[1,3]thiazolo[3,2-a]pyrimidin-7-one |
| SMILES | CCN(CC)c1cc(=O)nc2sccn12 |
| InChI | InChI=1S/C10H13N3OS/c1-3-12(4-2)9-7-8(14)11-10-13(9)5-6-15-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | JNMFADVDIFMSGX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |