C8H10N2OS2 — CID 131235703
(E)-3-methylsulfanyl-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide (PubChem CID 131235703) has the molecular formula C8H10N2OS2 and a molecular weight of 214.32 g/mol. Its IUPAC name is (E)-3-methylsulfanyl-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide.
| Compound Name | (E)-3-methylsulfanyl-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide |
|---|---|
| PubChem CID | 131235703 |
| Molecular Formula | C8H10N2OS2 |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | (E)-3-methylsulfanyl-N-(3-methyl-1,3-thiazol-2-ylidene)prop-2-enamide |
| SMILES | CS/C=C/C(=O)/N=c1\sccn1C |
| InChI | InChI=1S/C8H10N2OS2/c1-10-4-6-13-8(10)9-7(11)3-5-12-2/h3-6H,1-2H3/b5-3+,9-8- |
| InChIKey | IUUAXWQVNLVRQK-QRSZSCANSA-N |
| XLogP | 1.39 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|