C23H23ClN6O — CID 143198886
N-(4-chloro-3-pyridin-2-ylphenyl)-6-[3-(4,5-dihydroimidazol-1-yl)propylamino]pyridine-3-carboxamide (PubChem CID 143198886) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is N-(4-chloro-3-pyridin-2-ylphenyl)-6-[3-(4,5-dihydroimidazol-1-yl)propylamino]pyridine-3-carboxamide.
| Compound Name | N-(4-chloro-3-pyridin-2-ylphenyl)-6-[3-(4,5-dihydroimidazol-1-yl)propylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143198886 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | N-(4-chloro-3-pyridin-2-ylphenyl)-6-[3-(4,5-dihydroimidazol-1-yl)propylamino]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(-c2ccccn2)c1)c1ccc(NCCCN2C=NCC2)nc1 |
| InChI | InChI=1S/C23H23ClN6O/c24-20-7-6-18(14-19(20)21-4-1-2-9-26-21)29-23(31)17-5-8-22(28-15-17)27-10-3-12-30-13-11-25-16-30/h1-2,4-9,14-16H,3,10-13H2,(H,27,28)(H,29,31) |
| InChIKey | IUJNKNSLZFKXJI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|