About ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene
ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene (PubChem CID 143200335) has the molecular formula C19H25N3
and a molecular weight of 295.43 g/mol. Its IUPAC name is ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene.
Molecular Properties
| Compound Name | ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene |
| PubChem CID | 143200335 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene |
| SMILES | C=C.C=CC.C=CC(=C)C/N=C/c1nc2ccccc2n1C |
| InChI | InChI=1S/C14H15N3.C3H6.C2H4/c1-4-11(2)9-15-10-14-16-12-7-5-6-8-13(12)17(14)3;1-3-2;1-2/h4-8,10H,1-2,9H2,3H3;3H,1H2,2H3;1-2H2/b15-10+;; |
| InChIKey | NNUKBQIBKIVQHQ-OVWKBUNZSA-N |
| XLogP | 4.73 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene?
The IUPAC name of ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene (CID 143200335) is ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene.
What is the SMILES notation for ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene?
The canonical SMILES for ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene is C=C.C=CC.C=CC(=C)C/N=C/c1nc2ccccc2n1C.
What is the InChIKey of ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene?
The InChIKey is NNUKBQIBKIVQHQ-OVWKBUNZSA-N. The full InChI is InChI=1S/C14H15N3.C3H6.C2H4/c1-4-11(2)9-15-10-14-16-12-7-5-6-8-13(12)17(14)3;1-3-2;1-2/h4-8,10H,1-2,9H2,3H3;3H,1H2,2H3;1-2H2/b15-10+;;.
What are the key properties of ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene?
ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene has a molecular weight of 295.43 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-(1-methylbenzimidazol-2-yl)-N-(2-methylidenebut-3-enyl)methanimine;prop-1-ene is sourced from PubChem (CID 143200335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).