C14H22O3 — CID 143202172
propyl 2-methyl-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]oxypropanoate (PubChem CID 143202172) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is propyl 2-methyl-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]oxypropanoate.
| Compound Name | propyl 2-methyl-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]oxypropanoate |
|---|---|
| PubChem CID | 143202172 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | propyl 2-methyl-2-[(3E)-2-methylhexa-1,3,5-trien-3-yl]oxypropanoate |
| SMILES | C=C/C=C(/OC(C)(C)C(=O)OCCC)C(=C)C |
| InChI | InChI=1S/C14H22O3/c1-7-9-12(11(3)4)17-14(5,6)13(15)16-10-8-2/h7,9H,1,3,8,10H2,2,4-6H3/b12-9+ |
| InChIKey | BTIAVWKJMRFXJL-FMIVXFBMSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|