C17H28O3 — CID 91525459
tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxypropanoate (PubChem CID 91525459) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxypropanoate.
| Compound Name | tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxypropanoate |
|---|---|
| PubChem CID | 91525459 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxypropanoate |
| SMILES | C=C(C=CC(=C)C(C)CC)OC(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H28O3/c1-9-12(2)13(3)10-11-14(4)19-15(5)16(18)20-17(6,7)8/h10-12,15H,3-4,9H2,1-2,5-8H3 |
| InChIKey | JDCBTLHUDLJRLH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|