C16H26O3 — CID 90999286
tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxyacetate (PubChem CID 90999286) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxyacetate.
| Compound Name | tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxyacetate |
|---|---|
| PubChem CID | 90999286 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | tert-butyl 2-(6-methyl-5-methylideneocta-1,3-dien-2-yl)oxyacetate |
| SMILES | C=C(C=CC(=C)C(C)CC)OCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H26O3/c1-8-12(2)13(3)9-10-14(4)18-11-15(17)19-16(5,6)7/h9-10,12H,3-4,8,11H2,1-2,5-7H3 |
| InChIKey | OYABQWSCTBOXSI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|