C23H42O3 — CID 123985067
tert-butyl 2-(7-tert-butyl-9,9-dimethyl-6-methylidenedec-4-en-3-yl)oxyacetate (PubChem CID 123985067) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is tert-butyl 2-(7-tert-butyl-9,9-dimethyl-6-methylidenedec-4-en-3-yl)oxyacetate.
| Compound Name | tert-butyl 2-(7-tert-butyl-9,9-dimethyl-6-methylidenedec-4-en-3-yl)oxyacetate |
|---|---|
| PubChem CID | 123985067 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | tert-butyl 2-(7-tert-butyl-9,9-dimethyl-6-methylidenedec-4-en-3-yl)oxyacetate |
| SMILES | C=C(C=CC(CC)OCC(=O)OC(C)(C)C)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C23H42O3/c1-12-18(25-16-20(24)26-23(9,10)11)14-13-17(2)19(22(6,7)8)15-21(3,4)5/h13-14,18-19H,2,12,15-16H2,1,3-11H3 |
| InChIKey | WQBLPOKBWLHIEJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|