C29H48O3 — CID 58292419
methyl 3-deuterio-2-[(2Z,6E,13E)-3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy]propanoate (PubChem CID 58292419) has the molecular formula C29H48O3 and a molecular weight of 445.71 g/mol. Its IUPAC name is methyl 3-deuterio-2-[(2Z,6E,13E)-3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy]propanoate.
| Compound Name | methyl 3-deuterio-2-[(2Z,6E,13E)-3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy]propanoate |
|---|---|
| PubChem CID | 58292419 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 445.71 g/mol |
| Exact Mass | 445.37 |
| IUPAC Name | methyl 3-deuterio-2-[(2Z,6E,13E)-3,8,8,14,18-pentamethyl-11-methylidenenonadeca-2,6,13,17-tetraenoxy]propanoate |
| SMILES | [2H]CC(OC/C=C(/C)CC/C=C/C(C)(C)CCC(=C)C/C=C(\C)CCC=C(C)C)C(=O)OC |
| InChI | InChI=1S/C29H48O3/c1-23(2)13-12-15-24(3)16-17-26(5)18-21-29(7,8)20-11-10-14-25(4)19-22-32-27(6)28(30)31-9/h11,13,16,19-20,27H,5,10,12,14-15,17-18,21-22H2,1-4,6-9H3/b20-11+,24-16+,25-19-/i6D |
| InChIKey | QQTAGTUSFPFYNM-JZFZORONSA-N |
| XLogP | 8.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.71 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|