C21H34O3 — CID 59977342
methyl 2-[(2Z,5Z,8Z,10E,12S)-12-methylheptadeca-2,5,8,10-tetraenoxy]acetate (PubChem CID 59977342) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is methyl 2-[(2Z,5Z,8Z,10E,12S)-12-methylheptadeca-2,5,8,10-tetraenoxy]acetate.
| Compound Name | methyl 2-[(2Z,5Z,8Z,10E,12S)-12-methylheptadeca-2,5,8,10-tetraenoxy]acetate |
|---|---|
| PubChem CID | 59977342 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | methyl 2-[(2Z,5Z,8Z,10E,12S)-12-methylheptadeca-2,5,8,10-tetraenoxy]acetate |
| SMILES | CCCCC[C@H](C)/C=C/C=C\C/C=C\C/C=C\COCC(=O)OC |
| InChI | InChI=1S/C21H34O3/c1-4-5-13-16-20(2)17-14-11-9-7-6-8-10-12-15-18-24-19-21(22)23-3/h6,8-9,11-12,14-15,17,20H,4-5,7,10,13,16,18-19H2,1-3H3/b8-6-,11-9-,15-12-,17-14+/t20-/m0/s1 |
| InChIKey | CZUXVHCVEUSWQS-VTNSQPLRSA-N |
| XLogP | 5.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|