C19H34O3 — CID 123654534
propan-2-yl (7S)-2-methoxy-3,7,11-trimethyldodeca-2,4-dienoate (PubChem CID 123654534) has the molecular formula C19H34O3 and a molecular weight of 310.48 g/mol. Its IUPAC name is propan-2-yl (7S)-2-methoxy-3,7,11-trimethyldodeca-2,4-dienoate.
| Compound Name | propan-2-yl (7S)-2-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
|---|---|
| PubChem CID | 123654534 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | propan-2-yl (7S)-2-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| SMILES | COC(C(=O)OC(C)C)=C(C)C=CC[C@@H](C)CCCC(C)C |
| InChI | InChI=1S/C19H34O3/c1-14(2)10-8-11-16(5)12-9-13-17(6)18(21-7)19(20)22-15(3)4/h9,13-16H,8,10-12H2,1-7H3/t16-/m0/s1 |
| InChIKey | BLBICPRFEANLPD-INIZCTEOSA-N |
| XLogP | 5.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|