C16H27NO — CID 143203271
2,2-dimethyl-1-piperidin-4-yl-4,5,6,7-tetrahydro-3H-inden-1-ol (PubChem CID 143203271) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 2,2-dimethyl-1-piperidin-4-yl-4,5,6,7-tetrahydro-3H-inden-1-ol.
| Compound Name | 2,2-dimethyl-1-piperidin-4-yl-4,5,6,7-tetrahydro-3H-inden-1-ol |
|---|---|
| PubChem CID | 143203271 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 2,2-dimethyl-1-piperidin-4-yl-4,5,6,7-tetrahydro-3H-inden-1-ol |
| SMILES | CC1(C)CC2=C(CCCC2)C1(O)C1CCNCC1 |
| InChI | InChI=1S/C16H27NO/c1-15(2)11-12-5-3-4-6-14(12)16(15,18)13-7-9-17-10-8-13/h13,17-18H,3-11H2,1-2H3 |
| InChIKey | AJATXHBOJPTSBH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|