C21H27ClFNO2 — CID 143203376
2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol (PubChem CID 143203376) has the molecular formula C21H27ClFNO2 and a molecular weight of 379.90 g/mol. Its IUPAC name is 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol.
| Compound Name | 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol |
|---|---|
| PubChem CID | 143203376 |
| Molecular Formula | C21H27ClFNO2 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol |
| SMILES | CCC(C)c1ccc(Cc2cccc(Cl)c2F)cn1.OC1CCCCO1 |
| InChI | InChI=1S/C16H17ClFN.C5H10O2/c1-3-11(2)15-8-7-12(10-19-15)9-13-5-4-6-14(17)16(13)18;6-5-3-1-2-4-7-5/h4-8,10-11H,3,9H2,1-2H3;5-6H,1-4H2 |
| InChIKey | QKOFKCCWKOFKSA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |