About 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol
2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol (PubChem CID 143203376) has the molecular formula C21H27ClFNO2
and a molecular weight of 379.90 g/mol. Its IUPAC name is 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol.
Molecular Properties
| Compound Name | 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol |
| PubChem CID | 143203376 |
| Molecular Formula | C21H27ClFNO2 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol |
| SMILES | CCC(C)c1ccc(Cc2cccc(Cl)c2F)cn1.OC1CCCCO1 |
| InChI | InChI=1S/C16H17ClFN.C5H10O2/c1-3-11(2)15-8-7-12(10-19-15)9-13-5-4-6-14(17)16(13)18;6-5-3-1-2-4-7-5/h4-8,10-11H,3,9H2,1-2H3;5-6H,1-4H2 |
| InChIKey | QKOFKCCWKOFKSA-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol?
The IUPAC name of 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol (CID 143203376) is 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol.
What is the SMILES notation for 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol?
The canonical SMILES for 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol is CCC(C)c1ccc(Cc2cccc(Cl)c2F)cn1.OC1CCCCO1.
What is the InChIKey of 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol?
The InChIKey is QKOFKCCWKOFKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClFN.C5H10O2/c1-3-11(2)15-8-7-12(10-19-15)9-13-5-4-6-14(17)16(13)18;6-5-3-1-2-4-7-5/h4-8,10-11H,3,9H2,1-2H3;5-6H,1-4H2.
What are the key properties of 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol?
2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol has a molecular weight of 379.90 g/mol, XLogP of 5.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-5-[(3-chloro-2-fluorophenyl)methyl]pyridine;oxan-2-ol is sourced from PubChem (CID 143203376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).