C21H25ClFNO3 — CID 58626751
2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-pyridinyl]-4-(oxan-2-yloxy)butan-1-ol (PubChem CID 58626751) has the molecular formula C21H25ClFNO3 and a molecular weight of 393.89 g/mol. Its IUPAC name is 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-pyridinyl]-4-(oxan-2-yloxy)butan-1-ol.
| Compound Name | 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-pyridinyl]-4-(oxan-2-yloxy)butan-1-ol |
|---|---|
| PubChem CID | 58626751 |
| Molecular Formula | C21H25ClFNO3 |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[5-[(3-chloro-2-fluorophenyl)methyl]-2-pyridinyl]-4-(oxan-2-yloxy)butan-1-ol |
| SMILES | OCC(CCOC1CCCCO1)c1ccc(Cc2cccc(Cl)c2F)cn1 |
| InChI | InChI=1S/C21H25ClFNO3/c22-18-5-3-4-16(21(18)23)12-15-7-8-19(24-13-15)17(14-25)9-11-27-20-6-1-2-10-26-20/h3-5,7-8,13,17,20,25H,1-2,6,9-12,14H2 |
| InChIKey | LRFONBGTIDNWBE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |