C17H14N4OS — CID 143204417
1-[7-(3-aminophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenylsulfanylprop-2-en-1-one (PubChem CID 143204417) has the molecular formula C17H14N4OS and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-[7-(3-aminophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenylsulfanylprop-2-en-1-one.
| Compound Name | 1-[7-(3-aminophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenylsulfanylprop-2-en-1-one |
|---|---|
| PubChem CID | 143204417 |
| Molecular Formula | C17H14N4OS |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 1-[7-(3-aminophenyl)pyrazolo[1,5-a]pyrimidin-3-yl]-2-ethenylsulfanylprop-2-en-1-one |
| SMILES | C=CSC(=C)C(=O)c1cnn2c(-c3cccc(N)c3)ccnc12 |
| InChI | InChI=1S/C17H14N4OS/c1-3-23-11(2)16(22)14-10-20-21-15(7-8-19-17(14)21)12-5-4-6-13(18)9-12/h3-10H,1-2,18H2 |
| InChIKey | IMKFZGSKMCUQAX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 73.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|