C8H17NOS — CID 143204673
3-[(2S)-2-methylbutyl]-1,3-thiazolidin-4-ol (PubChem CID 143204673) has the molecular formula C8H17NOS and a molecular weight of 175.30 g/mol. Its IUPAC name is 3-[(2S)-2-methylbutyl]-1,3-thiazolidin-4-ol.
| Compound Name | 3-[(2S)-2-methylbutyl]-1,3-thiazolidin-4-ol |
|---|---|
| PubChem CID | 143204673 |
| Molecular Formula | C8H17NOS |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-[(2S)-2-methylbutyl]-1,3-thiazolidin-4-ol |
| SMILES | CC[C@H](C)CN1CSCC1O |
| InChI | InChI=1S/C8H17NOS/c1-3-7(2)4-9-6-11-5-8(9)10/h7-8,10H,3-6H2,1-2H3/t7-,8?/m0/s1 |
| InChIKey | SCHNBDFHYFABFW-JAMMHHFISA-N |
| XLogP | 1.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |