C23H23BrN2O2 — CID 143206576
ethyl 1-[2-(4-bromophenyl)quinolin-4-yl]piperidine-4-carboxylate (PubChem CID 143206576) has the molecular formula C23H23BrN2O2 and a molecular weight of 439.35 g/mol. Its IUPAC name is ethyl 1-[2-(4-bromophenyl)quinolin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-bromophenyl)quinolin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 143206576 |
| Molecular Formula | C23H23BrN2O2 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | ethyl 1-[2-(4-bromophenyl)quinolin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2cc(-c3ccc(Br)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C23H23BrN2O2/c1-2-28-23(27)17-11-13-26(14-12-17)22-15-21(16-7-9-18(24)10-8-16)25-20-6-4-3-5-19(20)22/h3-10,15,17H,2,11-14H2,1H3 |
| InChIKey | AWJMAIYCZQRQFR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |