C19H21ClN4OS — CID 143206607
2-[[4-[(6-chloro-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenol (PubChem CID 143206607) has the molecular formula C19H21ClN4OS and a molecular weight of 388.92 g/mol. Its IUPAC name is 2-[[4-[(6-chloro-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenol.
| Compound Name | 2-[[4-[(6-chloro-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 143206607 |
| Molecular Formula | C19H21ClN4OS |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[[4-[(6-chloro-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]methyl]phenol |
| SMILES | Cc1c(Cl)sc2ncnc(NC3CCN(Cc4ccccc4O)CC3)c12 |
| InChI | InChI=1S/C19H21ClN4OS/c1-12-16-18(21-11-22-19(16)26-17(12)20)23-14-6-8-24(9-7-14)10-13-4-2-3-5-15(13)25/h2-5,11,14,25H,6-10H2,1H3,(H,21,22,23) |
| InChIKey | AKUDLBGGLLEXNV-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|