C28H37IN2O4 — CID 143207387
2-[4-[2-[[1-(5-iodo-2-piperidin-1-ylphenyl)-3-methylbutyl]amino]-2-oxoethyl]phenoxy]-2-methylpropanoic acid (PubChem CID 143207387) has the molecular formula C28H37IN2O4 and a molecular weight of 592.52 g/mol. Its IUPAC name is 2-[4-[2-[[1-(5-iodo-2-piperidin-1-ylphenyl)-3-methylbutyl]amino]-2-oxoethyl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[4-[2-[[1-(5-iodo-2-piperidin-1-ylphenyl)-3-methylbutyl]amino]-2-oxoethyl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 143207387 |
| Molecular Formula | C28H37IN2O4 |
| Molecular Weight | 592.52 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 2-[4-[2-[[1-(5-iodo-2-piperidin-1-ylphenyl)-3-methylbutyl]amino]-2-oxoethyl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)Cc1ccc(OC(C)(C)C(=O)O)cc1)c1cc(I)ccc1N1CCCCC1 |
| InChI | InChI=1S/C28H37IN2O4/c1-19(2)16-24(23-18-21(29)10-13-25(23)31-14-6-5-7-15-31)30-26(32)17-20-8-11-22(12-9-20)35-28(3,4)27(33)34/h8-13,18-19,24H,5-7,14-17H2,1-4H3,(H,30,32)(H,33,34) |
| InChIKey | UVQYDKJBIFNPCP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|