About prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol
prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol (PubChem CID 143207585) has the molecular formula C15H31NO
and a molecular weight of 241.42 g/mol. Its IUPAC name is prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol.
Molecular Properties
| Compound Name | prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol |
| PubChem CID | 143207585 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol |
| SMILES | C=CC.CCCC1CCCCC1CCNCO |
| InChI | InChI=1S/C12H25NO.C3H6/c1-2-5-11-6-3-4-7-12(11)8-9-13-10-14;1-3-2/h11-14H,2-10H2,1H3;3H,1H2,2H3 |
| InChIKey | IZGCZJWEWJUWQZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol?
The IUPAC name of prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol (CID 143207585) is prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol.
What is the SMILES notation for prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol?
The canonical SMILES for prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol is C=CC.CCCC1CCCCC1CCNCO.
What is the InChIKey of prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol?
The InChIKey is IZGCZJWEWJUWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO.C3H6/c1-2-5-11-6-3-4-7-12(11)8-9-13-10-14;1-3-2/h11-14H,2-10H2,1H3;3H,1H2,2H3.
What are the key properties of prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol?
prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol has a molecular weight of 241.42 g/mol, XLogP of 3.71, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for prop-1-ene;[2-(2-propylcyclohexyl)ethylamino]methanol is sourced from PubChem (CID 143207585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).