C27H36ClN3O2 — CID 143209873
7-[4-[4-(5-chloro-6-methylcyclohepta-1,3,5-trien-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;ethene (PubChem CID 143209873) has the molecular formula C27H36ClN3O2 and a molecular weight of 470.06 g/mol. Its IUPAC name is 7-[4-[4-(5-chloro-6-methylcyclohepta-1,3,5-trien-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;ethene.
| Compound Name | 7-[4-[4-(5-chloro-6-methylcyclohepta-1,3,5-trien-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;ethene |
|---|---|
| PubChem CID | 143209873 |
| Molecular Formula | C27H36ClN3O2 |
| Molecular Weight | 470.06 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | 7-[4-[4-(5-chloro-6-methylcyclohepta-1,3,5-trien-1-yl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one;ethene |
| SMILES | C=C.CC1=C(Cl)C=CC=C(N2CCN(CCCCOc3ccc4c(c3)NC(=O)CC4)CC2)C1 |
| InChI | InChI=1S/C25H32ClN3O2.C2H4/c1-19-17-21(5-4-6-23(19)26)29-14-12-28(13-15-29)11-2-3-16-31-22-9-7-20-8-10-25(30)27-24(20)18-22;1-2/h4-7,9,18H,2-3,8,10-17H2,1H3,(H,27,30);1-2H2 |
| InChIKey | BTUFWMPZLVVXNB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.06 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|