C21H32O — CID 143210170
2-[2-(4-methylcyclohexyl)ethyl]-5-(4-methylphenyl)oxane (PubChem CID 143210170) has the molecular formula C21H32O and a molecular weight of 300.49 g/mol. Its IUPAC name is 2-[2-(4-methylcyclohexyl)ethyl]-5-(4-methylphenyl)oxane.
| Compound Name | 2-[2-(4-methylcyclohexyl)ethyl]-5-(4-methylphenyl)oxane |
|---|---|
| PubChem CID | 143210170 |
| Molecular Formula | C21H32O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | 2-[2-(4-methylcyclohexyl)ethyl]-5-(4-methylphenyl)oxane |
| SMILES | Cc1ccc(C2CCC(CCC3CCC(C)CC3)OC2)cc1 |
| InChI | InChI=1S/C21H32O/c1-16-3-7-18(8-4-16)9-13-21-14-12-20(15-22-21)19-10-5-17(2)6-11-19/h5-6,10-11,16,18,20-21H,3-4,7-9,12-15H2,1-2H3 |
| InChIKey | UJJBUCZFRRENKT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |