C24H40O2 — CID 143210065
ethane;ethene;4-[6-[2-(4-methylcyclohexyl)ethyl]oxan-3-yl]phenol (PubChem CID 143210065) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is ethane;ethene;4-[6-[2-(4-methylcyclohexyl)ethyl]oxan-3-yl]phenol.
| Compound Name | ethane;ethene;4-[6-[2-(4-methylcyclohexyl)ethyl]oxan-3-yl]phenol |
|---|---|
| PubChem CID | 143210065 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | ethane;ethene;4-[6-[2-(4-methylcyclohexyl)ethyl]oxan-3-yl]phenol |
| SMILES | C=C.CC.CC1CCC(CCC2CCC(c3ccc(O)cc3)CO2)CC1 |
| InChI | InChI=1S/C20H30O2.C2H6.C2H4/c1-15-2-4-16(5-3-15)6-12-20-13-9-18(14-22-20)17-7-10-19(21)11-8-17;2*1-2/h7-8,10-11,15-16,18,20-21H,2-6,9,12-14H2,1H3;1-2H3;1-2H2 |
| InChIKey | UEVUAFSWPWSKEA-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|