C26H27ClN2OS — CID 143210382
1-(4-butoxyphenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5,6-dimethylbenzimidazole (PubChem CID 143210382) has the molecular formula C26H27ClN2OS and a molecular weight of 451.04 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5,6-dimethylbenzimidazole.
| Compound Name | 1-(4-butoxyphenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 143210382 |
| Molecular Formula | C26H27ClN2OS |
| Molecular Weight | 451.04 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(4-butoxyphenyl)-2-[(4-chlorophenyl)methylsulfanyl]-5,6-dimethylbenzimidazole |
| SMILES | CCCCOc1ccc(-n2c(SCc3ccc(Cl)cc3)nc3cc(C)c(C)cc32)cc1 |
| InChI | InChI=1S/C26H27ClN2OS/c1-4-5-14-30-23-12-10-22(11-13-23)29-25-16-19(3)18(2)15-24(25)28-26(29)31-17-20-6-8-21(27)9-7-20/h6-13,15-16H,4-5,14,17H2,1-3H3 |
| InChIKey | WJDQLLVHOBRJHJ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.04 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|