C22H18BrIN2OS — CID 89343122
5-bromo-2-[[4-(iodomethyl)phenyl]methylsulfanyl]-1-(4-methoxyphenyl)benzimidazole (PubChem CID 89343122) has the molecular formula C22H18BrIN2OS and a molecular weight of 565.27 g/mol. Its IUPAC name is 5-bromo-2-[[4-(iodomethyl)phenyl]methylsulfanyl]-1-(4-methoxyphenyl)benzimidazole.
| Compound Name | 5-bromo-2-[[4-(iodomethyl)phenyl]methylsulfanyl]-1-(4-methoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 89343122 |
| Molecular Formula | C22H18BrIN2OS |
| Molecular Weight | 565.27 g/mol |
| Exact Mass | 563.94 |
| IUPAC Name | 5-bromo-2-[[4-(iodomethyl)phenyl]methylsulfanyl]-1-(4-methoxyphenyl)benzimidazole |
| SMILES | COc1ccc(-n2c(SCc3ccc(CI)cc3)nc3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C22H18BrIN2OS/c1-27-19-9-7-18(8-10-19)26-21-11-6-17(23)12-20(21)25-22(26)28-14-16-4-2-15(13-24)3-5-16/h2-12H,13-14H2,1H3 |
| InChIKey | AZOQLSFCEISGTJ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.27 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|