C23H20BrIN2OS — CID 89343284
2-[(4-bromophenyl)methylsulfanyl]-1-(4-ethoxyphenyl)-7-(iodomethyl)benzimidazole (PubChem CID 89343284) has the molecular formula C23H20BrIN2OS and a molecular weight of 579.30 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methylsulfanyl]-1-(4-ethoxyphenyl)-7-(iodomethyl)benzimidazole.
| Compound Name | 2-[(4-bromophenyl)methylsulfanyl]-1-(4-ethoxyphenyl)-7-(iodomethyl)benzimidazole |
|---|---|
| PubChem CID | 89343284 |
| Molecular Formula | C23H20BrIN2OS |
| Molecular Weight | 579.30 g/mol |
| Exact Mass | 577.95 |
| IUPAC Name | 2-[(4-bromophenyl)methylsulfanyl]-1-(4-ethoxyphenyl)-7-(iodomethyl)benzimidazole |
| SMILES | CCOc1ccc(-n2c(SCc3ccc(Br)cc3)nc3cccc(CI)c32)cc1 |
| InChI | InChI=1S/C23H20BrIN2OS/c1-2-28-20-12-10-19(11-13-20)27-22-17(14-25)4-3-5-21(22)26-23(27)29-15-16-6-8-18(24)9-7-16/h3-13H,2,14-15H2,1H3 |
| InChIKey | QPZCRFPDCJODHQ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.30 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|