C25H26N2OS — CID 71135740
4-[2-[(4-tert-butylphenyl)methylsulfanyl]-7-methylbenzimidazol-1-yl]phenol (PubChem CID 71135740) has the molecular formula C25H26N2OS and a molecular weight of 402.56 g/mol. Its IUPAC name is 4-[2-[(4-tert-butylphenyl)methylsulfanyl]-7-methylbenzimidazol-1-yl]phenol.
| Compound Name | 4-[2-[(4-tert-butylphenyl)methylsulfanyl]-7-methylbenzimidazol-1-yl]phenol |
|---|---|
| PubChem CID | 71135740 |
| Molecular Formula | C25H26N2OS |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 4-[2-[(4-tert-butylphenyl)methylsulfanyl]-7-methylbenzimidazol-1-yl]phenol |
| SMILES | Cc1cccc2nc(SCc3ccc(C(C)(C)C)cc3)n(-c3ccc(O)cc3)c12 |
| InChI | InChI=1S/C25H26N2OS/c1-17-6-5-7-22-23(17)27(20-12-14-21(28)15-13-20)24(26-22)29-16-18-8-10-19(11-9-18)25(2,3)4/h5-15,28H,16H2,1-4H3 |
| InChIKey | RYOWXVZCYZPACY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |