C22H18Cl2N2O2S — CID 66648557
6-chloro-2-[(4-chlorophenyl)methylsulfanyl]-1-[4-(methoxymethoxy)phenyl]benzimidazole (PubChem CID 66648557) has the molecular formula C22H18Cl2N2O2S and a molecular weight of 445.37 g/mol. Its IUPAC name is 6-chloro-2-[(4-chlorophenyl)methylsulfanyl]-1-[4-(methoxymethoxy)phenyl]benzimidazole.
| Compound Name | 6-chloro-2-[(4-chlorophenyl)methylsulfanyl]-1-[4-(methoxymethoxy)phenyl]benzimidazole |
|---|---|
| PubChem CID | 66648557 |
| Molecular Formula | C22H18Cl2N2O2S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 6-chloro-2-[(4-chlorophenyl)methylsulfanyl]-1-[4-(methoxymethoxy)phenyl]benzimidazole |
| SMILES | COCOc1ccc(-n2c(SCc3ccc(Cl)cc3)nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O2S/c1-27-14-28-19-9-7-18(8-10-19)26-21-12-17(24)6-11-20(21)25-22(26)29-13-15-2-4-16(23)5-3-15/h2-12H,13-14H2,1H3 |
| InChIKey | XMIJLURBTMFSBH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|