C22H19ClN2OS — CID 143210390
2-[(2-chlorophenyl)methylsulfanyl]-1-(4-methoxyphenyl)-6-methylbenzimidazole (PubChem CID 143210390) has the molecular formula C22H19ClN2OS and a molecular weight of 394.93 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-1-(4-methoxyphenyl)-6-methylbenzimidazole.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-1-(4-methoxyphenyl)-6-methylbenzimidazole |
|---|---|
| PubChem CID | 143210390 |
| Molecular Formula | C22H19ClN2OS |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-1-(4-methoxyphenyl)-6-methylbenzimidazole |
| SMILES | COc1ccc(-n2c(SCc3ccccc3Cl)nc3ccc(C)cc32)cc1 |
| InChI | InChI=1S/C22H19ClN2OS/c1-15-7-12-20-21(13-15)25(17-8-10-18(26-2)11-9-17)22(24-20)27-14-16-5-3-4-6-19(16)23/h3-13H,14H2,1-2H3 |
| InChIKey | IJYOCDCZNXSHRZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |