C20H14Cl2N2S — CID 4257609
2-[(2,4-dichlorophenyl)methylsulfanyl]-1-phenylbenzimidazole (PubChem CID 4257609) has the molecular formula C20H14Cl2N2S and a molecular weight of 385.32 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfanyl]-1-phenylbenzimidazole.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 4257609 |
| Molecular Formula | C20H14Cl2N2S |
| Molecular Weight | 385.32 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfanyl]-1-phenylbenzimidazole |
| SMILES | Clc1ccc(CSc2nc3ccccc3n2-c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2N2S/c21-15-11-10-14(17(22)12-15)13-25-20-23-18-8-4-5-9-19(18)24(20)16-6-2-1-3-7-16/h1-12H,13H2 |
| InChIKey | ZLEYUCSADIKOJW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.32 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |