C23H18Cl3N3OS — CID 69243092
4-[6-chloro-2-[(4-chlorophenyl)methylsulfanyl]benzimidazol-1-yl]-N-(2-chloroethyl)benzamide (PubChem CID 69243092) has the molecular formula C23H18Cl3N3OS and a molecular weight of 490.84 g/mol. Its IUPAC name is 4-[6-chloro-2-[(4-chlorophenyl)methylsulfanyl]benzimidazol-1-yl]-N-(2-chloroethyl)benzamide.
| Compound Name | 4-[6-chloro-2-[(4-chlorophenyl)methylsulfanyl]benzimidazol-1-yl]-N-(2-chloroethyl)benzamide |
|---|---|
| PubChem CID | 69243092 |
| Molecular Formula | C23H18Cl3N3OS |
| Molecular Weight | 490.84 g/mol |
| Exact Mass | 489.02 |
| IUPAC Name | 4-[6-chloro-2-[(4-chlorophenyl)methylsulfanyl]benzimidazol-1-yl]-N-(2-chloroethyl)benzamide |
| SMILES | O=C(NCCCl)c1ccc(-n2c(SCc3ccc(Cl)cc3)nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C23H18Cl3N3OS/c24-11-12-27-22(30)16-3-8-19(9-4-16)29-21-13-18(26)7-10-20(21)28-23(29)31-14-15-1-5-17(25)6-2-15/h1-10,13H,11-12,14H2,(H,27,30) |
| InChIKey | QAYGIMJHRXZWDM-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.84 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|