C32H38F3N5O — CID 143211118
3-[2-[3-(diethylamino)propylimino]-4-methyl-3,4-dihydro-1H-quinazolin-6-yl]-4-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 143211118) has the molecular formula C32H38F3N5O and a molecular weight of 565.68 g/mol. Its IUPAC name is 3-[2-[3-(diethylamino)propylimino]-4-methyl-3,4-dihydro-1H-quinazolin-6-yl]-4-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-[2-[3-(diethylamino)propylimino]-4-methyl-3,4-dihydro-1H-quinazolin-6-yl]-4-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 143211118 |
| Molecular Formula | C32H38F3N5O |
| Molecular Weight | 565.68 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 3-[2-[3-(diethylamino)propylimino]-4-methyl-3,4-dihydro-1H-quinazolin-6-yl]-4-methyl-N-[2-methyl-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCN(CC)CCC/N=C1/Nc2ccc(-c3cc(C(=O)Nc4cccc(C(F)(F)F)c4C)ccc3C)cc2C(C)N1 |
| InChI | InChI=1S/C32H38F3N5O/c1-6-40(7-2)17-9-16-36-31-37-22(5)26-18-23(14-15-29(26)39-31)25-19-24(13-12-20(25)3)30(41)38-28-11-8-10-27(21(28)4)32(33,34)35/h8,10-15,18-19,22H,6-7,9,16-17H2,1-5H3,(H,38,41)(H2,36,37,39) |
| InChIKey | LUYXHEWRMZPNEL-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|