C30H25F9O2 — CID 143211278
(3R)-7-[4-[1,2-difluoro-1-(3,4,5-trifluorophenoxy)ethyl]-3,5-difluorophenyl]-6,8-difluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene (PubChem CID 143211278) has the molecular formula C30H25F9O2 and a molecular weight of 588.51 g/mol. Its IUPAC name is (3R)-7-[4-[1,2-difluoro-1-(3,4,5-trifluorophenoxy)ethyl]-3,5-difluorophenyl]-6,8-difluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene.
| Compound Name | (3R)-7-[4-[1,2-difluoro-1-(3,4,5-trifluorophenoxy)ethyl]-3,5-difluorophenyl]-6,8-difluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 143211278 |
| Molecular Formula | C30H25F9O2 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | (3R)-7-[4-[1,2-difluoro-1-(3,4,5-trifluorophenoxy)ethyl]-3,5-difluorophenyl]-6,8-difluoro-3-(4-methylcyclohexyl)-3,4-dihydro-2H-chromene |
| SMILES | CC1CCC([C@@H]2COc3c(cc(F)c(-c4cc(F)c(C(F)(CF)Oc5cc(F)c(F)c(F)c5)c(F)c4)c3F)C2)CC1 |
| InChI | InChI=1S/C30H25F9O2/c1-14-2-4-15(5-3-14)18-6-17-9-20(32)25(28(38)29(17)40-12-18)16-7-21(33)26(22(34)8-16)30(39,13-31)41-19-10-23(35)27(37)24(36)11-19/h7-11,14-15,18H,2-6,12-13H2,1H3/t14?,15?,18-,30?/m0/s1 |
| InChIKey | YTWIKMZOJGLIIY-YIIZYSBHSA-N |
| XLogP | 8.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|