C18H18ClFN4O — CID 143211386
[(1E)-1-[5-(2-chlorophenyl)-7-fluoro-8-methoxy-1,2-dihydro-1,4-benzodiazepin-3-ylidene]ethyl]hydrazine (PubChem CID 143211386) has the molecular formula C18H18ClFN4O and a molecular weight of 360.82 g/mol. Its IUPAC name is [(1E)-1-[5-(2-chlorophenyl)-7-fluoro-8-methoxy-1,2-dihydro-1,4-benzodiazepin-3-ylidene]ethyl]hydrazine.
| Compound Name | [(1E)-1-[5-(2-chlorophenyl)-7-fluoro-8-methoxy-1,2-dihydro-1,4-benzodiazepin-3-ylidene]ethyl]hydrazine |
|---|---|
| PubChem CID | 143211386 |
| Molecular Formula | C18H18ClFN4O |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | [(1E)-1-[5-(2-chlorophenyl)-7-fluoro-8-methoxy-1,2-dihydro-1,4-benzodiazepin-3-ylidene]ethyl]hydrazine |
| SMILES | COc1cc2c(cc1F)C(c1ccccc1Cl)=N/C(=C(\C)NN)CN2 |
| InChI | InChI=1S/C18H18ClFN4O/c1-10(24-21)16-9-22-15-8-17(25-2)14(20)7-12(15)18(23-16)11-5-3-4-6-13(11)19/h3-8,22,24H,9,21H2,1-2H3/b16-10+ |
| InChIKey | XCZLYTPBURHYSQ-MHWRWJLKSA-N |
| XLogP | 3.45 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|