C19H18ClFN2OS — CID 175253555
5-(2-chlorophenyl)-7-fluoro-8-propoxy-2,3-dihydro-1H-1,4-benzodiazepine-2-carbothialdehyde (PubChem CID 175253555) has the molecular formula C19H18ClFN2OS and a molecular weight of 376.88 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-7-fluoro-8-propoxy-2,3-dihydro-1H-1,4-benzodiazepine-2-carbothialdehyde.
| Compound Name | 5-(2-chlorophenyl)-7-fluoro-8-propoxy-2,3-dihydro-1H-1,4-benzodiazepine-2-carbothialdehyde |
|---|---|
| PubChem CID | 175253555 |
| Molecular Formula | C19H18ClFN2OS |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 5-(2-chlorophenyl)-7-fluoro-8-propoxy-2,3-dihydro-1H-1,4-benzodiazepine-2-carbothialdehyde |
| SMILES | CCCOc1cc2c(cc1F)C(c1ccccc1Cl)=NCC(C=S)N2 |
| InChI | InChI=1S/C19H18ClFN2OS/c1-2-7-24-18-9-17-14(8-16(18)21)19(22-10-12(11-25)23-17)13-5-3-4-6-15(13)20/h3-6,8-9,11-12,23H,2,7,10H2,1H3 |
| InChIKey | YUXBTXBHAVZPRZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|