C18H26O2 — CID 143212024
(2E,3E)-2,3-di(ethylidene)-6-[(2Z,4E)-hepta-2,4-dien-4-yl]pyran-4-one;ethane (PubChem CID 143212024) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (2E,3E)-2,3-di(ethylidene)-6-[(2Z,4E)-hepta-2,4-dien-4-yl]pyran-4-one;ethane.
| Compound Name | (2E,3E)-2,3-di(ethylidene)-6-[(2Z,4E)-hepta-2,4-dien-4-yl]pyran-4-one;ethane |
|---|---|
| PubChem CID | 143212024 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (2E,3E)-2,3-di(ethylidene)-6-[(2Z,4E)-hepta-2,4-dien-4-yl]pyran-4-one;ethane |
| SMILES | C/C=C\C(=C/CC)c1cc(=O)c(=C/C)/c(=C\C)o1.CC |
| InChI | InChI=1S/C16H20O2.C2H6/c1-5-9-12(10-6-2)16-11-14(17)13(7-3)15(8-4)18-16;1-2/h5,7-11H,6H2,1-4H3;1-2H3/b9-5-,12-10+,13-7-,15-8+; |
| InChIKey | RJIWTTQEFYPLQV-PZLFVBTCSA-N |
| XLogP | 3.64 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|