C22H30O2 — CID 135025838
2-(4,8-dimethylnona-3,7-dienyl)-2,7-dimethyl-3H-chromen-5-one (PubChem CID 135025838) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 2-(4,8-dimethylnona-3,7-dienyl)-2,7-dimethyl-3H-chromen-5-one.
| Compound Name | 2-(4,8-dimethylnona-3,7-dienyl)-2,7-dimethyl-3H-chromen-5-one |
|---|---|
| PubChem CID | 135025838 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-(4,8-dimethylnona-3,7-dienyl)-2,7-dimethyl-3H-chromen-5-one |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)CC=C2C(=O)C=C(C)C=C2O1 |
| InChI | InChI=1S/C22H30O2/c1-16(2)8-6-9-17(3)10-7-12-22(5)13-11-19-20(23)14-18(4)15-21(19)24-22/h8,10-11,14-15H,6-7,9,12-13H2,1-5H3 |
| InChIKey | FUUFSKZEBUIWCF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|