About methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate
methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate (PubChem CID 143212762) has the molecular formula C16H26N2O4
and a molecular weight of 310.39 g/mol. Its IUPAC name is methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate.
Molecular Properties
| Compound Name | methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate |
| PubChem CID | 143212762 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate |
| SMILES | C.CCCCCOc1cc(/C(C)=N/OC(N)=O)ccc1OC |
| InChI | InChI=1S/C15H22N2O4.CH4/c1-4-5-6-9-20-14-10-12(7-8-13(14)19-3)11(2)17-21-15(16)18;/h7-8,10H,4-6,9H2,1-3H3,(H2,16,18);1H4/b17-11+; |
| InChIKey | NUCVNTTXQNNWBX-SJDTYFKWSA-N |
| XLogP | 3.72 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate?
The IUPAC name of methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate (CID 143212762) is methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate.
What is the SMILES notation for methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate?
The canonical SMILES for methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate is C.CCCCCOc1cc(/C(C)=N/OC(N)=O)ccc1OC.
What is the InChIKey of methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate?
The InChIKey is NUCVNTTXQNNWBX-SJDTYFKWSA-N. The full InChI is InChI=1S/C15H22N2O4.CH4/c1-4-5-6-9-20-14-10-12(7-8-13(14)19-3)11(2)17-21-15(16)18;/h7-8,10H,4-6,9H2,1-3H3,(H2,16,18);1H4/b17-11+;.
What are the key properties of methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate?
methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate has a molecular weight of 310.39 g/mol, XLogP of 3.72, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;[(E)-1-(4-methoxy-3-pentoxyphenyl)ethylideneamino] carbamate is sourced from PubChem (CID 143212762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).