C15H11F2NO3 — CID 143212775
1-[8-amino-4-(difluoromethoxy)dibenzofuran-1-yl]ethanone (PubChem CID 143212775) has the molecular formula C15H11F2NO3 and a molecular weight of 291.25 g/mol. Its IUPAC name is 1-[8-amino-4-(difluoromethoxy)dibenzofuran-1-yl]ethanone.
| Compound Name | 1-[8-amino-4-(difluoromethoxy)dibenzofuran-1-yl]ethanone |
|---|---|
| PubChem CID | 143212775 |
| Molecular Formula | C15H11F2NO3 |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-[8-amino-4-(difluoromethoxy)dibenzofuran-1-yl]ethanone |
| SMILES | CC(=O)c1ccc(OC(F)F)c2oc3ccc(N)cc3c12 |
| InChI | InChI=1S/C15H11F2NO3/c1-7(19)9-3-5-12(21-15(16)17)14-13(9)10-6-8(18)2-4-11(10)20-14/h2-6,15H,18H2,1H3 |
| InChIKey | IAXXSCINQROAGC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|