C23H16Cl3F2N3O4 — CID 140504441
8-N-(3-chloropropyl)-8-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)dibenzofuran-1,8-dicarboxamide (PubChem CID 140504441) has the molecular formula C23H16Cl3F2N3O4 and a molecular weight of 542.75 g/mol. Its IUPAC name is 8-N-(3-chloropropyl)-8-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)dibenzofuran-1,8-dicarboxamide.
| Compound Name | 8-N-(3-chloropropyl)-8-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)dibenzofuran-1,8-dicarboxamide |
|---|---|
| PubChem CID | 140504441 |
| Molecular Formula | C23H16Cl3F2N3O4 |
| Molecular Weight | 542.75 g/mol |
| Exact Mass | 541.02 |
| IUPAC Name | 8-N-(3-chloropropyl)-8-N-(3,5-dichloro-4-pyridinyl)-4-(difluoromethoxy)dibenzofuran-1,8-dicarboxamide |
| SMILES | NC(=O)c1ccc(OC(F)F)c2oc3ccc(C(=O)N(CCCCl)c4c(Cl)cncc4Cl)cc3c12 |
| InChI | InChI=1S/C23H16Cl3F2N3O4/c24-6-1-7-31(19-14(25)9-30-10-15(19)26)22(33)11-2-4-16-13(8-11)18-12(21(29)32)3-5-17(20(18)34-16)35-23(27)28/h2-5,8-10,23H,1,6-7H2,(H2,29,32) |
| InChIKey | IJGMKWCSYRFWOU-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.75 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|